C19H24F3N3OS — CID 18158505
N-[1-(1-adamantyl)ethyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 18158505) has the molecular formula C19H24F3N3OS and a molecular weight of 399.48 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18158505 |
| Molecular Formula | C19H24F3N3OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | CC(NC(=O)CSc1nccc(C(F)(F)F)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H24F3N3OS/c1-11(18-7-12-4-13(8-18)6-14(5-12)9-18)24-16(26)10-27-17-23-3-2-15(25-17)19(20,21)22/h2-3,11-14H,4-10H2,1H3,(H,24,26) |
| InChIKey | IDCYKQQMJZXILL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |