C16H12F3N5O2 — CID 18158615
3-(tetrazol-1-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide (PubChem CID 18158615) has the molecular formula C16H12F3N5O2 and a molecular weight of 363.30 g/mol. Its IUPAC name is 3-(tetrazol-1-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide.
| Compound Name | 3-(tetrazol-1-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 18158615 |
| Molecular Formula | C16H12F3N5O2 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-(tetrazol-1-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)cc1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H12F3N5O2/c17-16(18,19)9-26-14-6-4-12(5-7-14)21-15(25)11-2-1-3-13(8-11)24-10-20-22-23-24/h1-8,10H,9H2,(H,21,25) |
| InChIKey | XRXYWKGYLIFZGR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |