C17H17ClFNO — CID 18158661
N-[1-(4-chlorophenyl)propyl]-2-(2-fluorophenyl)acetamide (PubChem CID 18158661) has the molecular formula C17H17ClFNO and a molecular weight of 305.78 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)propyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[1-(4-chlorophenyl)propyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18158661 |
| Molecular Formula | C17H17ClFNO |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)propyl]-2-(2-fluorophenyl)acetamide |
| SMILES | CCC(NC(=O)Cc1ccccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClFNO/c1-2-16(12-7-9-14(18)10-8-12)20-17(21)11-13-5-3-4-6-15(13)19/h3-10,16H,2,11H2,1H3,(H,20,21) |
| InChIKey | XGTSEONYSNCWTD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |