C18H20N2O5S — CID 18158808
methyl 2-methoxy-5-[[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]methyl]benzoate (PubChem CID 18158808) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 2-methoxy-5-[[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 18158808 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl 2-methoxy-5-[[[2-[(5-methylthiophene-2-carbonyl)amino]acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CNC(=O)CNC(=O)c2ccc(C)s2)ccc1OC |
| InChI | InChI=1S/C18H20N2O5S/c1-11-4-7-15(26-11)17(22)20-10-16(21)19-9-12-5-6-14(24-2)13(8-12)18(23)25-3/h4-8H,9-10H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | FBQRNTFTEZNWFT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |