C21H23FN4O3S — CID 18159465
N'-[2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]adamantane-1-carbohydrazide (PubChem CID 18159465) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is N'-[2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]adamantane-1-carbohydrazide.
| Compound Name | N'-[2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 18159465 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N'-[2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]adamantane-1-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)o1)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23FN4O3S/c22-16-3-1-15(2-4-16)18-24-26-20(29-18)30-11-17(27)23-25-19(28)21-8-12-5-13(9-21)7-14(6-12)10-21/h1-4,12-14H,5-11H2,(H,23,27)(H,25,28) |
| InChIKey | CDZBROSDLXKZTI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|