C22H26N2O2S — CID 18161802
(2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(6-methoxynaphthalen-2-yl)propanamide (PubChem CID 18161802) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is (2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(6-methoxynaphthalen-2-yl)propanamide.
| Compound Name | (2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(6-methoxynaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 18161802 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2S)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-(6-methoxynaphthalen-2-yl)propanamide |
| SMILES | COc1ccc2cc([C@H](C)C(=O)NCC(c3cccs3)N(C)C)ccc2c1 |
| InChI | InChI=1S/C22H26N2O2S/c1-15(16-7-8-18-13-19(26-4)10-9-17(18)12-16)22(25)23-14-20(24(2)3)21-6-5-11-27-21/h5-13,15,20H,14H2,1-4H3,(H,23,25)/t15-,20?/m0/s1 |
| InChIKey | SFLZFDDYDKCCOC-OOJLDXBWSA-N |
| XLogP | 4.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |