C15H18N2O3 — CID 18164312
N-(2-hydroxy-4-methylphenyl)-3-methyl-5-propan-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 18164312) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylphenyl)-3-methyl-5-propan-2-yl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(2-hydroxy-4-methylphenyl)-3-methyl-5-propan-2-yl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 18164312 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(2-hydroxy-4-methylphenyl)-3-methyl-5-propan-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(C)noc2C(C)C)c(O)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-8(2)14-13(10(4)17-20-14)15(19)16-11-6-5-9(3)7-12(11)18/h5-8,18H,1-4H3,(H,16,19) |
| InChIKey | PTMJJYZZNCFMLC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|