C13H20N4O2 — CID 18164478
2-(carbamoylamino)-N-[[4-(dimethylamino)phenyl]methyl]propanamide (PubChem CID 18164478) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[[4-(dimethylamino)phenyl]methyl]propanamide.
| Compound Name | 2-(carbamoylamino)-N-[[4-(dimethylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 18164478 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-(carbamoylamino)-N-[[4-(dimethylamino)phenyl]methyl]propanamide |
| SMILES | CC(NC(N)=O)C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H20N4O2/c1-9(16-13(14)19)12(18)15-8-10-4-6-11(7-5-10)17(2)3/h4-7,9H,8H2,1-3H3,(H,15,18)(H3,14,16,19) |
| InChIKey | HVCHYLIXQMZGGD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|