C15H18N4O2 — CID 18165495
3-[2-(azepan-1-yl)-2-oxoethyl]pyrido[2,3-d]pyrimidin-4-one (PubChem CID 18165495) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18165495 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C(Cn1cnc2ncccc2c1=O)N1CCCCCC1 |
| InChI | InChI=1S/C15H18N4O2/c20-13(18-8-3-1-2-4-9-18)10-19-11-17-14-12(15(19)21)6-5-7-16-14/h5-7,11H,1-4,8-10H2 |
| InChIKey | HCKLBKNUZCYNDA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |