C16H22N4O4 — CID 18167356
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(2-methoxy-4-pyridinyl)methyl]butanamide (PubChem CID 18167356) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(2-methoxy-4-pyridinyl)methyl]butanamide.
| Compound Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(2-methoxy-4-pyridinyl)methyl]butanamide |
|---|---|
| PubChem CID | 18167356 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(2-methoxy-4-pyridinyl)methyl]butanamide |
| SMILES | COc1cc(CNC(=O)CCCN2C(=O)NC(C)(C)C2=O)ccn1 |
| InChI | InChI=1S/C16H22N4O4/c1-16(2)14(22)20(15(23)19-16)8-4-5-12(21)18-10-11-6-7-17-13(9-11)24-3/h6-7,9H,4-5,8,10H2,1-3H3,(H,18,21)(H,19,23) |
| InChIKey | JYYPSGIGBDJUDE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|