C13H25N5OS — CID 18167539
2-[(5-tert-butyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl-methylamino]-N-propylacetamide (PubChem CID 18167539) has the molecular formula C13H25N5OS and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[(5-tert-butyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl-methylamino]-N-propylacetamide.
| Compound Name | 2-[(5-tert-butyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 18167539 |
| Molecular Formula | C13H25N5OS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-[(5-tert-butyl-3-sulfanylidene-1H-1,2,4-triazol-2-yl)methyl-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)Cn1[nH]c(C(C)(C)C)nc1=S |
| InChI | InChI=1S/C13H25N5OS/c1-6-7-14-10(19)8-17(5)9-18-12(20)15-11(16-18)13(2,3)4/h6-9H2,1-5H3,(H,14,19)(H,15,16,20) |
| InChIKey | FOKXFQYQHHNBTI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|