C17H18ClN3O3S — CID 18169535
[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 18169535) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is [2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 18169535 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(Cc2ccc(Cl)s2)CC1)c1ccccn1 |
| InChI | InChI=1S/C17H18ClN3O3S/c18-15-5-4-13(25-15)11-20-7-9-21(10-8-20)16(22)12-24-17(23)14-3-1-2-6-19-14/h1-6H,7-12H2 |
| InChIKey | YHMUPPNWFNSLFD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |