About (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate
(5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate (PubChem CID 18169981) has the molecular formula C14H15N3O4
and a molecular weight of 289.29 g/mol. Its IUPAC name is (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate.
Molecular Properties
| Compound Name | (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate |
| PubChem CID | 18169981 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate |
| SMILES | CC(=O)Nc1c(C)cccc1C(=O)OCc1nnc(C)o1 |
| InChI | InChI=1S/C14H15N3O4/c1-8-5-4-6-11(13(8)15-9(2)18)14(19)20-7-12-17-16-10(3)21-12/h4-6H,7H2,1-3H3,(H,15,18) |
| InChIKey | JSGSYAMMRVEEQJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate?
The IUPAC name of (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate (CID 18169981) is (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate.
What is the SMILES notation for (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate?
The canonical SMILES for (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate is CC(=O)Nc1c(C)cccc1C(=O)OCc1nnc(C)o1.
What is the InChIKey of (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate?
The InChIKey is JSGSYAMMRVEEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O4/c1-8-5-4-6-11(13(8)15-9(2)18)14(19)20-7-12-17-16-10(3)21-12/h4-6H,7H2,1-3H3,(H,15,18).
What are the key properties of (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate?
(5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate has a molecular weight of 289.29 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3,4-oxadiazol-2-yl)methyl 2-acetamido-3-methylbenzoate is sourced from PubChem (CID 18169981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).