C17H22N2O4S2 — CID 18170668
4-methoxy-N-methyl-3-(propan-2-ylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 18170668) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-methoxy-N-methyl-3-(propan-2-ylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-methoxy-N-methyl-3-(propan-2-ylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18170668 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-methoxy-N-methyl-3-(propan-2-ylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(C)Cc2cccs2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C17H22N2O4S2/c1-12(2)18-25(21,22)16-10-13(7-8-15(16)23-4)17(20)19(3)11-14-6-5-9-24-14/h5-10,12,18H,11H2,1-4H3 |
| InChIKey | XUTHRUFCBGHFES-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |