C11H9Cl3N4 — CID 18171624
5-(3-chlorophenyl)-2-[(2,2-dichlorocyclopropyl)methyl]tetrazole (PubChem CID 18171624) has the molecular formula C11H9Cl3N4 and a molecular weight of 303.58 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-[(2,2-dichlorocyclopropyl)methyl]tetrazole.
| Compound Name | 5-(3-chlorophenyl)-2-[(2,2-dichlorocyclopropyl)methyl]tetrazole |
|---|---|
| PubChem CID | 18171624 |
| Molecular Formula | C11H9Cl3N4 |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 5-(3-chlorophenyl)-2-[(2,2-dichlorocyclopropyl)methyl]tetrazole |
| SMILES | Clc1cccc(-c2nnn(CC3CC3(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C11H9Cl3N4/c12-9-3-1-2-7(4-9)10-15-17-18(16-10)6-8-5-11(8,13)14/h1-4,8H,5-6H2 |
| InChIKey | MHQVRDVIURXYDD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|