About 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile
5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile (PubChem CID 18171760) has the molecular formula C19H15N3O3S
and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile |
| PubChem CID | 18171760 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile |
| SMILES | CC(=O)c1cc(C#N)c(SCCN2C(=O)c3ccccc3C2=O)nc1C |
| InChI | InChI=1S/C19H15N3O3S/c1-11-16(12(2)23)9-13(10-20)17(21-11)26-8-7-22-18(24)14-5-3-4-6-15(14)19(22)25/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | QDOAAPJXPRFOFR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 91.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile?
The IUPAC name of 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile (CID 18171760) is 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile.
What is the SMILES notation for 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile?
The canonical SMILES for 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile is CC(=O)c1cc(C#N)c(SCCN2C(=O)c3ccccc3C2=O)nc1C.
What is the InChIKey of 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile?
The InChIKey is QDOAAPJXPRFOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O3S/c1-11-16(12(2)23)9-13(10-20)17(21-11)26-8-7-22-18(24)14-5-3-4-6-15(14)19(22)25/h3-6,9H,7-8H2,1-2H3.
What are the key properties of 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile?
5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile has a molecular weight of 365.41 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-methylpyridine-3-carbonitrile is sourced from PubChem (CID 18171760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).