C8H16N6O — CID 18172234
1-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]butan-1-ol (PubChem CID 18172234) has the molecular formula C8H16N6O and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]butan-1-ol.
| Compound Name | 1-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]butan-1-ol |
|---|---|
| PubChem CID | 18172234 |
| Molecular Formula | C8H16N6O |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 1-[(4,6-diamino-1,3,5-triazin-2-yl)-methylamino]butan-1-ol |
| SMILES | CCCC(O)N(C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C8H16N6O/c1-3-4-5(15)14(2)8-12-6(9)11-7(10)13-8/h5,15H,3-4H2,1-2H3,(H4,9,10,11,12,13) |
| InChIKey | OEGCQNXOOLMUNY-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|