About (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one
(2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one (PubChem CID 18172370) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one |
| PubChem CID | 18172370 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one |
| SMILES | O=C(/C(CN1CCCCC1)=N\O)N1CCCCC1 |
| InChI | InChI=1S/C13H23N3O2/c17-13(16-9-5-2-6-10-16)12(14-18)11-15-7-3-1-4-8-15/h18H,1-11H2/b14-12- |
| InChIKey | FPFRIXBCHMSLOI-OWBHPGMISA-N |
| XLogP | 1.32 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one?
The IUPAC name of (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one (CID 18172370) is (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one.
What is the SMILES notation for (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one?
The canonical SMILES for (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one is O=C(/C(CN1CCCCC1)=N\O)N1CCCCC1.
What is the InChIKey of (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one?
The InChIKey is FPFRIXBCHMSLOI-OWBHPGMISA-N. The full InChI is InChI=1S/C13H23N3O2/c17-13(16-9-5-2-6-10-16)12(14-18)11-15-7-3-1-4-8-15/h18H,1-11H2/b14-12-.
What are the key properties of (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one?
(2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one has a molecular weight of 253.35 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-hydroxyimino-1,3-di(piperidin-1-yl)propan-1-one is sourced from PubChem (CID 18172370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).