C22H18F3NO — CID 18172420
6-methoxy-2-phenyl-1-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 18172420) has the molecular formula C22H18F3NO and a molecular weight of 369.39 g/mol. Its IUPAC name is 6-methoxy-2-phenyl-1-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-methoxy-2-phenyl-1-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 18172420 |
| Molecular Formula | C22H18F3NO |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 6-methoxy-2-phenyl-1-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc2c(c1)CCN(c1ccccc1)C2c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C22H18F3NO/c1-27-17-7-8-18-14(11-17)9-10-26(16-5-3-2-4-6-16)22(18)15-12-19(23)21(25)20(24)13-15/h2-8,11-13,22H,9-10H2,1H3 |
| InChIKey | WFNLFYBJIRDJBW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|