About 2,3-dibromo-4H-chromene
2,3-dibromo-4H-chromene (PubChem CID 18172585) has the molecular formula C9H6Br2O
and a molecular weight of 289.95 g/mol. Its IUPAC name is 2,3-dibromo-4H-chromene.
Molecular Properties
| Compound Name | 2,3-dibromo-4H-chromene |
| PubChem CID | 18172585 |
| Molecular Formula | C9H6Br2O |
| Molecular Weight | 289.95 g/mol |
| Exact Mass | 287.88 |
| IUPAC Name | 2,3-dibromo-4H-chromene |
| SMILES | BrC1=C(Br)Oc2ccccc2C1 |
| InChI | InChI=1S/C9H6Br2O/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-4H,5H2 |
| InChIKey | PRHDYDHZEFWTOI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dibromo-4H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-4H-chromene?
The IUPAC name of 2,3-dibromo-4H-chromene (CID 18172585) is 2,3-dibromo-4H-chromene.
What is the SMILES notation for 2,3-dibromo-4H-chromene?
The canonical SMILES for 2,3-dibromo-4H-chromene is BrC1=C(Br)Oc2ccccc2C1.
What is the InChIKey of 2,3-dibromo-4H-chromene?
The InChIKey is PRHDYDHZEFWTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Br2O/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-4H,5H2.
What are the key properties of 2,3-dibromo-4H-chromene?
2,3-dibromo-4H-chromene has a molecular weight of 289.95 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-4H-chromene is sourced from PubChem (CID 18172585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).