C26H40Cl2N6O3 — CID 18172719
2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[8-[[2-(1,4-dimethylpiperazin-1-ium-1-yl)acetyl]amino]-1-hydroxynaphthalen-2-yl]acetamide dichloride (PubChem CID 18172719) has the molecular formula C26H40Cl2N6O3 and a molecular weight of 555.55 g/mol. Its IUPAC name is 2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[8-[[2-(1,4-dimethylpiperazin-1-ium-1-yl)acetyl]amino]-1-hydroxynaphthalen-2-yl]acetamide dichloride.
| Compound Name | 2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[8-[[2-(1,4-dimethylpiperazin-1-ium-1-yl)acetyl]amino]-1-hydroxynaphthalen-2-yl]acetamide dichloride |
|---|---|
| PubChem CID | 18172719 |
| Molecular Formula | C26H40Cl2N6O3 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[8-[[2-(1,4-dimethylpiperazin-1-ium-1-yl)acetyl]amino]-1-hydroxynaphthalen-2-yl]acetamide dichloride |
| SMILES | CN1CC[N+](C)(CC(=O)Nc2ccc3cccc(NC(=O)C[N+]4(C)CCN(C)CC4)c3c2O)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C26H38N6O3.2ClH/c1-29-10-14-31(3,15-11-29)18-23(33)27-21-7-5-6-20-8-9-22(26(35)25(20)21)28-24(34)19-32(4)16-12-30(2)13-17-32;;/h5-9H,10-19H2,1-4H3,(H-2,27,28,33,34,35);2*1H |
| InChIKey | DRZNEZWINXBWPB-UHFFFAOYSA-N |
| XLogP | -4.79 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|