About 2,2-bis(butylamino)ethanol
2,2-bis(butylamino)ethanol (PubChem CID 18172892) has the molecular formula C10H24N2O
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2,2-bis(butylamino)ethanol.
Molecular Properties
| Compound Name | 2,2-bis(butylamino)ethanol |
| PubChem CID | 18172892 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 2,2-bis(butylamino)ethanol |
| SMILES | CCCCNC(CO)NCCCC |
| InChI | InChI=1S/C10H24N2O/c1-3-5-7-11-10(9-13)12-8-6-4-2/h10-13H,3-9H2,1-2H3 |
| InChIKey | QIHZVZCBJZMCAB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(butylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(butylamino)ethanol?
The IUPAC name of 2,2-bis(butylamino)ethanol (CID 18172892) is 2,2-bis(butylamino)ethanol.
What is the SMILES notation for 2,2-bis(butylamino)ethanol?
The canonical SMILES for 2,2-bis(butylamino)ethanol is CCCCNC(CO)NCCCC.
What is the InChIKey of 2,2-bis(butylamino)ethanol?
The InChIKey is QIHZVZCBJZMCAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O/c1-3-5-7-11-10(9-13)12-8-6-4-2/h10-13H,3-9H2,1-2H3.
What are the key properties of 2,2-bis(butylamino)ethanol?
2,2-bis(butylamino)ethanol has a molecular weight of 188.31 g/mol, XLogP of 1.08, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(butylamino)ethanol is sourced from PubChem (CID 18172892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).