C26H37N3O4S — CID 18173830
N-[4-(2,2-dimethoxyethyl)phenyl]-1-(4-piperidin-1-ylsulfonylphenyl)piperidin-4-amine (PubChem CID 18173830) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is N-[4-(2,2-dimethoxyethyl)phenyl]-1-(4-piperidin-1-ylsulfonylphenyl)piperidin-4-amine.
| Compound Name | N-[4-(2,2-dimethoxyethyl)phenyl]-1-(4-piperidin-1-ylsulfonylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 18173830 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[4-(2,2-dimethoxyethyl)phenyl]-1-(4-piperidin-1-ylsulfonylphenyl)piperidin-4-amine |
| SMILES | COC(Cc1ccc(NC2CCN(c3ccc(S(=O)(=O)N4CCCCC4)cc3)CC2)cc1)OC |
| InChI | InChI=1S/C26H37N3O4S/c1-32-26(33-2)20-21-6-8-22(9-7-21)27-23-14-18-28(19-15-23)24-10-12-25(13-11-24)34(30,31)29-16-4-3-5-17-29/h6-13,23,26-27H,3-5,14-20H2,1-2H3 |
| InChIKey | TWPNOVIXYRRGPV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|