C45H52N2O7 — CID 18174150
N-(4-ethoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine (PubChem CID 18174150) has the molecular formula C45H52N2O7 and a molecular weight of 732.92 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-ethoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 18174150 |
| Molecular Formula | C45H52N2O7 |
| Molecular Weight | 732.92 g/mol |
| Exact Mass | 732.38 |
| IUPAC Name | N-(4-ethoxyphenyl)-N,1-bis[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine |
| SMILES | CCOc1ccc(N(Cc2cccc(-c3cc(OC)c(OC)c(OC)c3)c2)C2CCN(Cc3cccc(-c4cc(OC)c(OC)c(OC)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C45H52N2O7/c1-8-54-39-17-15-37(16-18-39)47(30-32-12-10-14-34(24-32)36-27-42(50-4)45(53-7)43(28-36)51-5)38-19-21-46(22-20-38)29-31-11-9-13-33(23-31)35-25-40(48-2)44(52-6)41(26-35)49-3/h9-18,23-28,38H,8,19-22,29-30H2,1-7H3 |
| InChIKey | DPGOUYYQHNQDFU-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 71.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.92 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|