C36H32F4N4O — CID 18174274
N,1-bis[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine (PubChem CID 18174274) has the molecular formula C36H32F4N4O and a molecular weight of 612.67 g/mol. Its IUPAC name is N,1-bis[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine.
| Compound Name | N,1-bis[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 18174274 |
| Molecular Formula | C36H32F4N4O |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | N,1-bis[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine |
| SMILES | COc1ccc(N(Cc2ccnc(-c3ccc(F)c(F)c3)c2)C2CCN(Cc3ccnc(-c4ccc(F)c(F)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C36H32F4N4O/c1-45-30-6-4-28(5-7-30)44(23-25-11-15-42-36(19-25)27-3-9-32(38)34(40)21-27)29-12-16-43(17-13-29)22-24-10-14-41-35(18-24)26-2-8-31(37)33(39)20-26/h2-11,14-15,18-21,29H,12-13,16-17,22-23H2,1H3 |
| InChIKey | NDZODGPWTVZMBU-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|