About [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone
[3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 18174476) has the molecular formula C26H22N2O4
and a molecular weight of 426.47 g/mol. Its IUPAC name is [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone |
| PubChem CID | 18174476 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(N)c(N)c3ccccc3c2C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O4/c1-31-17-11-7-15(8-12-17)25(29)21-19-5-3-4-6-20(19)23(27)24(28)22(21)26(30)16-9-13-18(32-2)14-10-16/h3-14H,27-28H2,1-2H3 |
| InChIKey | KIOARRVXDVEZKH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone?
The IUPAC name of [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone (CID 18174476) is [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone.
What is the SMILES notation for [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone?
The canonical SMILES for [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone is COc1ccc(C(=O)c2c(N)c(N)c3ccccc3c2C(=O)c2ccc(OC)cc2)cc1.
What is the InChIKey of [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone?
The InChIKey is KIOARRVXDVEZKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O4/c1-31-17-11-7-15(8-12-17)25(29)21-19-5-3-4-6-20(19)23(27)24(28)22(21)26(30)16-9-13-18(32-2)14-10-16/h3-14H,27-28H2,1-2H3.
What are the key properties of [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone?
[3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone has a molecular weight of 426.47 g/mol, XLogP of 4.48, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-diamino-2-(4-methoxybenzoyl)naphthalen-1-yl]-(4-methoxyphenyl)methanone is sourced from PubChem (CID 18174476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).