C25H26ClN3O2 — CID 18174698
4-(4-chlorophenyl)-2-(2-methylimidazol-1-yl)-5-[3-(2,4,6-trimethylphenoxy)propyl]-1,3-oxazole (PubChem CID 18174698) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2-methylimidazol-1-yl)-5-[3-(2,4,6-trimethylphenoxy)propyl]-1,3-oxazole.
| Compound Name | 4-(4-chlorophenyl)-2-(2-methylimidazol-1-yl)-5-[3-(2,4,6-trimethylphenoxy)propyl]-1,3-oxazole |
|---|---|
| PubChem CID | 18174698 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2-methylimidazol-1-yl)-5-[3-(2,4,6-trimethylphenoxy)propyl]-1,3-oxazole |
| SMILES | Cc1cc(C)c(OCCCc2oc(-n3ccnc3C)nc2-c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-16-14-17(2)24(18(3)15-16)30-13-5-6-22-23(20-7-9-21(26)10-8-20)28-25(31-22)29-12-11-27-19(29)4/h7-12,14-15H,5-6,13H2,1-4H3 |
| InChIKey | FWJWNKJSXSXMTG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|