C18H19FO4 — CID 18174704
ethyl 6-(4-fluoronaphthalen-1-yl)-5-hydroxy-6-oxohexanoate (PubChem CID 18174704) has the molecular formula C18H19FO4 and a molecular weight of 318.34 g/mol. Its IUPAC name is ethyl 6-(4-fluoronaphthalen-1-yl)-5-hydroxy-6-oxohexanoate.
| Compound Name | ethyl 6-(4-fluoronaphthalen-1-yl)-5-hydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 18174704 |
| Molecular Formula | C18H19FO4 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | ethyl 6-(4-fluoronaphthalen-1-yl)-5-hydroxy-6-oxohexanoate |
| SMILES | CCOC(=O)CCCC(O)C(=O)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C18H19FO4/c1-2-23-17(21)9-5-8-16(20)18(22)14-10-11-15(19)13-7-4-3-6-12(13)14/h3-4,6-7,10-11,16,20H,2,5,8-9H2,1H3 |
| InChIKey | KWRQHRJMPSNUJF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |