About 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine
2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine (PubChem CID 18174934) has the molecular formula C10H5F6N3
and a molecular weight of 281.16 g/mol. Its IUPAC name is 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine |
| PubChem CID | 18174934 |
| Molecular Formula | C10H5F6N3 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(-n2cccn2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6N3/c11-9(12,13)6-4-7(10(14,15)16)8(17-5-6)19-3-1-2-18-19/h1-5H |
| InChIKey | WVFOAKBYHOHCCN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine?
The IUPAC name of 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine (CID 18174934) is 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine.
What is the SMILES notation for 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine?
The canonical SMILES for 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine is FC(F)(F)c1cnc(-n2cccn2)c(C(F)(F)F)c1.
What is the InChIKey of 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine?
The InChIKey is WVFOAKBYHOHCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F6N3/c11-9(12,13)6-4-7(10(14,15)16)8(17-5-6)19-3-1-2-18-19/h1-5H.
What are the key properties of 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine?
2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine has a molecular weight of 281.16 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-yl-3,5-bis(trifluoromethyl)pyridine is sourced from PubChem (CID 18174934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).