About N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine
N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine (PubChem CID 18175291) has the molecular formula C19H40N4
and a molecular weight of 324.56 g/mol. Its IUPAC name is N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine |
| PubChem CID | 18175291 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.33 |
| IUPAC Name | N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine |
| SMILES | CN(CCCCNCCCNCCCCN(C)C1CC1)C1CC1 |
| InChI | InChI=1S/C19H40N4/c1-22(18-8-9-18)16-5-3-12-20-14-7-15-21-13-4-6-17-23(2)19-10-11-19/h18-21H,3-17H2,1-2H3 |
| InChIKey | NGXBQKDUGFRWSX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine?
The IUPAC name of N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine (CID 18175291) is N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine.
What is the SMILES notation for N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine?
The canonical SMILES for N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine is CN(CCCCNCCCNCCCCN(C)C1CC1)C1CC1.
What is the InChIKey of N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine?
The InChIKey is NGXBQKDUGFRWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40N4/c1-22(18-8-9-18)16-5-3-12-20-14-7-15-21-13-4-6-17-23(2)19-10-11-19/h18-21H,3-17H2,1-2H3.
What are the key properties of N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine?
N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine has a molecular weight of 324.56 g/mol, XLogP of 2.30, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N-[3-[4-[cyclopropyl(methyl)amino]butylamino]propyl]-N'-methylbutane-1,4-diamine is sourced from PubChem (CID 18175291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).