About 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole
5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole (PubChem CID 18175459) has the molecular formula C13H10F2N2S
and a molecular weight of 264.30 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 18175459 |
| Molecular Formula | C13H10F2N2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole |
| SMILES | Fc1ccc(C2CC(c3cccs3)=NN2)cc1F |
| InChI | InChI=1S/C13H10F2N2S/c14-9-4-3-8(6-10(9)15)11-7-12(17-16-11)13-2-1-5-18-13/h1-6,11,16H,7H2 |
| InChIKey | ITKFNUJUQJSFTQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
The IUPAC name of 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole (CID 18175459) is 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole is Fc1ccc(C2CC(c3cccs3)=NN2)cc1F.
What is the InChIKey of 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
The InChIKey is ITKFNUJUQJSFTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2N2S/c14-9-4-3-8(6-10(9)15)11-7-12(17-16-11)13-2-1-5-18-13/h1-6,11,16H,7H2.
What are the key properties of 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole has a molecular weight of 264.30 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-difluorophenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 18175459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).