C13H11ClFN3O4S — CID 18176012
methyl 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate (PubChem CID 18176012) has the molecular formula C13H11ClFN3O4S and a molecular weight of 359.77 g/mol. Its IUPAC name is methyl 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate.
| Compound Name | methyl 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate |
|---|---|
| PubChem CID | 18176012 |
| Molecular Formula | C13H11ClFN3O4S |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | methyl 2-chloro-5-(3,5-dimethyl-2,6-dioxo-4-sulfanylidene-1,3,5-triazinan-1-yl)-4-fluorobenzoate |
| SMILES | COC(=O)c1cc(-n2c(=O)n(C)c(=S)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C13H11ClFN3O4S/c1-16-11(20)18(12(21)17(2)13(16)23)9-4-6(10(19)22-3)7(14)5-8(9)15/h4-5H,1-3H3 |
| InChIKey | ZUUAJKOPGALTQT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|