About 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol
5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 18177399) has the molecular formula C8H7IO3
and a molecular weight of 278.04 g/mol. Its IUPAC name is 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol.
Molecular Properties
| Compound Name | 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol |
| PubChem CID | 18177399 |
| Molecular Formula | C8H7IO3 |
| Molecular Weight | 278.04 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | Oc1ccc2c(c1I)OCCO2 |
| InChI | InChI=1S/C8H7IO3/c9-7-5(10)1-2-6-8(7)12-4-3-11-6/h1-2,10H,3-4H2 |
| InChIKey | PPALRXVWXYNNPT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.04 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol?
The IUPAC name of 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol (CID 18177399) is 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol.
What is the SMILES notation for 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol?
The canonical SMILES for 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol is Oc1ccc2c(c1I)OCCO2.
What is the InChIKey of 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol?
The InChIKey is PPALRXVWXYNNPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO3/c9-7-5(10)1-2-6-8(7)12-4-3-11-6/h1-2,10H,3-4H2.
What are the key properties of 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol?
5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol has a molecular weight of 278.04 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2,3-dihydro-1,4-benzodioxin-6-ol is sourced from PubChem (CID 18177399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).