About 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide
1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide (PubChem CID 18177591) has the molecular formula C16H36O6
and a molecular weight of 324.46 g/mol. Its IUPAC name is 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide.
Molecular Properties
| Compound Name | 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide |
| PubChem CID | 18177591 |
| Molecular Formula | C16H36O6 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide |
| SMILES | CC(CCC(C)(C)OOC(C)(C)C)COOC(C)(C)C.OO |
| InChI | InChI=1S/C16H34O4.H2O2/c1-13(12-17-18-14(2,3)4)10-11-16(8,9)20-19-15(5,6)7;1-2/h13H,10-12H2,1-9H3;1-2H |
| InChIKey | STRFNFUYUCBLMZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide?
The IUPAC name of 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide (CID 18177591) is 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide.
What is the SMILES notation for 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide?
The canonical SMILES for 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide is CC(CCC(C)(C)OOC(C)(C)C)COOC(C)(C)C.OO.
What is the InChIKey of 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide?
The InChIKey is STRFNFUYUCBLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O4.H2O2/c1-13(12-17-18-14(2,3)4)10-11-16(8,9)20-19-15(5,6)7;1-2/h13H,10-12H2,1-9H3;1-2H.
What are the key properties of 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide?
1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide has a molecular weight of 324.46 g/mol, XLogP of 4.69, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(tert-butylperoxy)-2,5-dimethylhexane;hydrogen peroxide is sourced from PubChem (CID 18177591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).