C38H37F3O4 — CID 18177872
2-benzyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoyl]oxybenzoic acid (PubChem CID 18177872) has the molecular formula C38H37F3O4 and a molecular weight of 614.70 g/mol. Its IUPAC name is 2-benzyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoyl]oxybenzoic acid.
| Compound Name | 2-benzyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 18177872 |
| Molecular Formula | C38H37F3O4 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 2-benzyl-4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-[4-(trifluoromethyl)phenyl]propanoyl]oxybenzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(Cc3ccc(C(F)(F)F)cc3)C(=O)Oc3ccc(C(=O)O)c(Cc4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C38H37F3O4/c1-36(2)18-19-37(3,4)33-23-26(12-17-32(33)36)31(21-25-10-13-28(14-11-25)38(39,40)41)35(44)45-29-15-16-30(34(42)43)27(22-29)20-24-8-6-5-7-9-24/h5-17,22-23,31H,18-21H2,1-4H3,(H,42,43) |
| InChIKey | QXCHVAOHPJUQIZ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|