C16H16 — CID 18178
1-phenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 18178) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-phenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-phenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 18178 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-phenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | c1ccc(C2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-5,7-9,11,16H,6,10,12H2 |
| InChIKey | YSPDISPRPJFBCV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |