C10H11F6NO — CID 18178018
4-(1,1,2,3,3,3-hexafluoropropoxy)-1-methylcyclohexa-2,4-dien-1-amine (PubChem CID 18178018) has the molecular formula C10H11F6NO and a molecular weight of 275.19 g/mol. Its IUPAC name is 4-(1,1,2,3,3,3-hexafluoropropoxy)-1-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 4-(1,1,2,3,3,3-hexafluoropropoxy)-1-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 18178018 |
| Molecular Formula | C10H11F6NO |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-(1,1,2,3,3,3-hexafluoropropoxy)-1-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1(N)C=CC(OC(F)(F)C(F)C(F)(F)F)=CC1 |
| InChI | InChI=1S/C10H11F6NO/c1-8(17)4-2-6(3-5-8)18-10(15,16)7(11)9(12,13)14/h2-4,7H,5,17H2,1H3 |
| InChIKey | MJEAIYARIAOHHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |