C30H24N6S6 — CID 18179309
2-[2,3,4,5,6-pentakis(3-aminothiophen-2-yl)phenyl]thiophen-3-amine (PubChem CID 18179309) has the molecular formula C30H24N6S6 and a molecular weight of 660.97 g/mol. Its IUPAC name is 2-[2,3,4,5,6-pentakis(3-aminothiophen-2-yl)phenyl]thiophen-3-amine.
| Compound Name | 2-[2,3,4,5,6-pentakis(3-aminothiophen-2-yl)phenyl]thiophen-3-amine |
|---|---|
| PubChem CID | 18179309 |
| Molecular Formula | C30H24N6S6 |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 660.04 |
| IUPAC Name | 2-[2,3,4,5,6-pentakis(3-aminothiophen-2-yl)phenyl]thiophen-3-amine |
| SMILES | Nc1ccsc1-c1c(-c2sccc2N)c(-c2sccc2N)c(-c2sccc2N)c(-c2sccc2N)c1-c1sccc1N |
| InChI | InChI=1S/C30H24N6S6/c31-13-1-7-37-25(13)19-20(26-14(32)2-8-38-26)22(28-16(34)4-10-40-28)24(30-18(36)6-12-42-30)23(29-17(35)5-11-41-29)21(19)27-15(33)3-9-39-27/h1-12H,31-36H2 |
| InChIKey | XBKZSWPUVFRUPA-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |