C17H28N2 — CID 18179325
3,3-dimethyl-5,7-di(propan-2-yl)-1,2-dihydroindene-4,6-diamine (PubChem CID 18179325) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 3,3-dimethyl-5,7-di(propan-2-yl)-1,2-dihydroindene-4,6-diamine.
| Compound Name | 3,3-dimethyl-5,7-di(propan-2-yl)-1,2-dihydroindene-4,6-diamine |
|---|---|
| PubChem CID | 18179325 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 3,3-dimethyl-5,7-di(propan-2-yl)-1,2-dihydroindene-4,6-diamine |
| SMILES | CC(C)c1c(N)c(C(C)C)c2c(c1N)C(C)(C)CC2 |
| InChI | InChI=1S/C17H28N2/c1-9(2)12-11-7-8-17(5,6)14(11)16(19)13(10(3)4)15(12)18/h9-10H,7-8,18-19H2,1-6H3 |
| InChIKey | XTHQKYIKMOLYNN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|