About 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one
5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one (PubChem CID 18179693) has the molecular formula C15H12N2O5S
and a molecular weight of 332.34 g/mol. Its IUPAC name is 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one |
| PubChem CID | 18179693 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)Cc3ccc([N+](=O)[O-])cc3)ccc2N1 |
| InChI | InChI=1S/C15H12N2O5S/c18-15-8-11-7-13(5-6-14(11)16-15)23(21,22)9-10-1-3-12(4-2-10)17(19)20/h1-7H,8-9H2,(H,16,18) |
| InChIKey | XJIWTXLIHPTCCS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one?
The IUPAC name of 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one (CID 18179693) is 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one?
The canonical SMILES for 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one is O=C1Cc2cc(S(=O)(=O)Cc3ccc([N+](=O)[O-])cc3)ccc2N1.
What is the InChIKey of 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one?
The InChIKey is XJIWTXLIHPTCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O5S/c18-15-8-11-7-13(5-6-14(11)16-15)23(21,22)9-10-1-3-12(4-2-10)17(19)20/h1-7H,8-9H2,(H,16,18).
What are the key properties of 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one?
5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one has a molecular weight of 332.34 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-nitrophenyl)methylsulfonyl]-1,3-dihydroindol-2-one is sourced from PubChem (CID 18179693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).