About 2-methoxy-5,6,7,8-tetrahydroquinoline
2-methoxy-5,6,7,8-tetrahydroquinoline (PubChem CID 18180283) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methoxy-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 2-methoxy-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 18180283 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-methoxy-5,6,7,8-tetrahydroquinoline |
| SMILES | COc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C10H13NO/c1-12-10-7-6-8-4-2-3-5-9(8)11-10/h6-7H,2-5H2,1H3 |
| InChIKey | JHMZTXNXIOTPLE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 2-methoxy-5,6,7,8-tetrahydroquinoline (CID 18180283) is 2-methoxy-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 2-methoxy-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 2-methoxy-5,6,7,8-tetrahydroquinoline is COc1ccc2c(n1)CCCC2.
What is the InChIKey of 2-methoxy-5,6,7,8-tetrahydroquinoline?
The InChIKey is JHMZTXNXIOTPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-12-10-7-6-8-4-2-3-5-9(8)11-10/h6-7H,2-5H2,1H3.
What are the key properties of 2-methoxy-5,6,7,8-tetrahydroquinoline?
2-methoxy-5,6,7,8-tetrahydroquinoline has a molecular weight of 163.22 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 18180283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).