C18H22N4OS — CID 18180793
2-(2-aminophenyl)-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 18180793) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 18180793 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(2-aminophenyl)-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CC1C(NC(=O)c2cnc(-c3ccccc3N)s2)C2CCN1CC2 |
| InChI | InChI=1S/C18H22N4OS/c1-11-16(12-6-8-22(11)9-7-12)21-17(23)15-10-20-18(24-15)13-4-2-3-5-14(13)19/h2-5,10-12,16H,6-9,19H2,1H3,(H,21,23) |
| InChIKey | YDFLLRBQEGPRME-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|