C18H21N3O3S3 — CID 18181464
N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(3-sulfamoylphenyl)sulfanylthiophene-2-carboxamide (PubChem CID 18181464) has the molecular formula C18H21N3O3S3 and a molecular weight of 423.59 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(3-sulfamoylphenyl)sulfanylthiophene-2-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(3-sulfamoylphenyl)sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18181464 |
| Molecular Formula | C18H21N3O3S3 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(3-sulfamoylphenyl)sulfanylthiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(Sc2ccc(C(=O)NC3CN4CCC3CC4)s2)c1 |
| InChI | InChI=1S/C18H21N3O3S3/c19-27(23,24)14-3-1-2-13(10-14)25-17-5-4-16(26-17)18(22)20-15-11-21-8-6-12(15)7-9-21/h1-5,10,12,15H,6-9,11H2,(H,20,22)(H2,19,23,24) |
| InChIKey | CXTBAVDSKUGFNT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |