About butanimidamide
butanimidamide (PubChem CID 18182) has the molecular formula C4H10N2
and a molecular weight of 86.14 g/mol. Its IUPAC name is butanimidamide.
Molecular Properties
| Compound Name | butanimidamide |
| PubChem CID | 18182 |
| Molecular Formula | C4H10N2 |
| Molecular Weight | 86.14 g/mol |
| Exact Mass | 86.08 |
| IUPAC Name | butanimidamide |
| SMILES | [H]/N=C(/N)CCC |
| InChI | InChI=1S/C4H10N2/c1-2-3-4(5)6/h2-3H2,1H3,(H3,5,6) |
| InChIKey | RXKUYBRRTKRGME-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanimidamide?
The IUPAC name of butanimidamide (CID 18182) is butanimidamide.
What is the SMILES notation for butanimidamide?
The canonical SMILES for butanimidamide is [H]/N=C(/N)CCC.
What is the InChIKey of butanimidamide?
The InChIKey is RXKUYBRRTKRGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2/c1-2-3-4(5)6/h2-3H2,1H3,(H3,5,6).
What are the key properties of butanimidamide?
butanimidamide has a molecular weight of 86.14 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanimidamide is sourced from PubChem (CID 18182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).