C18H19ClN2O2S — CID 18182118
N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-chlorophenoxy)thiophene-2-carboxamide (PubChem CID 18182118) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-chlorophenoxy)thiophene-2-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-chlorophenoxy)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18182118 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(4-chlorophenoxy)thiophene-2-carboxamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(Oc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H19ClN2O2S/c19-13-1-3-14(4-2-13)23-17-6-5-16(24-17)18(22)20-15-11-21-9-7-12(15)8-10-21/h1-6,12,15H,7-11H2,(H,20,22) |
| InChIKey | BAWQLSFASRMENW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |