About 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine
2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine (PubChem CID 18182235) has the molecular formula C16H15F2IN2
and a molecular weight of 400.21 g/mol. Its IUPAC name is 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine.
Molecular Properties
| Compound Name | 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine |
| PubChem CID | 18182235 |
| Molecular Formula | C16H15F2IN2 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine |
| SMILES | FC1CN(c2ccc(I)c(Cc3ccccc3)n2)CC1F |
| InChI | InChI=1S/C16H15F2IN2/c17-12-9-21(10-13(12)18)16-7-6-14(19)15(20-16)8-11-4-2-1-3-5-11/h1-7,12-13H,8-10H2 |
| InChIKey | RTDLQBLKCQTEEZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine?
The IUPAC name of 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine (CID 18182235) is 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine.
What is the SMILES notation for 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine?
The canonical SMILES for 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine is FC1CN(c2ccc(I)c(Cc3ccccc3)n2)CC1F.
What is the InChIKey of 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine?
The InChIKey is RTDLQBLKCQTEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2IN2/c17-12-9-21(10-13(12)18)16-7-6-14(19)15(20-16)8-11-4-2-1-3-5-11/h1-7,12-13H,8-10H2.
What are the key properties of 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine?
2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine has a molecular weight of 400.21 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)-3-iodopyridine is sourced from PubChem (CID 18182235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).