About [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate
[2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate (PubChem CID 18182279) has the molecular formula C19H17F3N2O6S
and a molecular weight of 458.41 g/mol. Its IUPAC name is [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate |
| PubChem CID | 18182279 |
| Molecular Formula | C19H17F3N2O6S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate |
| SMILES | O=C1N(c2ccc(OS(=O)(=O)C(F)(F)F)c(Cc3ccccc3)n2)CCC12OCCO2 |
| InChI | InChI=1S/C19H17F3N2O6S/c20-19(21,22)31(26,27)30-15-6-7-16(23-14(15)12-13-4-2-1-3-5-13)24-9-8-18(17(24)25)28-10-11-29-18/h1-7H,8-12H2 |
| InChIKey | OVDIFMPRIHBDFN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate?
The IUPAC name of [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate (CID 18182279) is [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate?
The canonical SMILES for [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate is O=C1N(c2ccc(OS(=O)(=O)C(F)(F)F)c(Cc3ccccc3)n2)CCC12OCCO2.
What is the InChIKey of [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate?
The InChIKey is OVDIFMPRIHBDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O6S/c20-19(21,22)31(26,27)30-15-6-7-16(23-14(15)12-13-4-2-1-3-5-13)24-9-8-18(17(24)25)28-10-11-29-18/h1-7H,8-12H2.
What are the key properties of [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate?
[2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate has a molecular weight of 458.41 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-benzyl-6-(6-oxo-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl)-3-pyridinyl] trifluoromethanesulfonate is sourced from PubChem (CID 18182279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).