C16H16F2N2 — CID 18182421
2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)pyridine (PubChem CID 18182421) has the molecular formula C16H16F2N2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)pyridine.
| Compound Name | 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 18182421 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-benzyl-6-(3,4-difluoropyrrolidin-1-yl)pyridine |
| SMILES | FC1CN(c2cccc(Cc3ccccc3)n2)CC1F |
| InChI | InChI=1S/C16H16F2N2/c17-14-10-20(11-15(14)18)16-8-4-7-13(19-16)9-12-5-2-1-3-6-12/h1-8,14-15H,9-11H2 |
| InChIKey | DDIOQJJYEVYIND-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |