About 4-pyridazin-3-ylbenzoic acid
4-pyridazin-3-ylbenzoic acid (PubChem CID 18182561) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-pyridazin-3-ylbenzoic acid.
Molecular Properties
| Compound Name | 4-pyridazin-3-ylbenzoic acid |
| PubChem CID | 18182561 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-pyridazin-3-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccnn2)cc1 |
| InChI | InChI=1S/C11H8N2O2/c14-11(15)9-5-3-8(4-6-9)10-2-1-7-12-13-10/h1-7H,(H,14,15) |
| InChIKey | FJBBZZOMNVFEHC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridazin-3-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridazin-3-ylbenzoic acid?
The IUPAC name of 4-pyridazin-3-ylbenzoic acid (CID 18182561) is 4-pyridazin-3-ylbenzoic acid.
What is the SMILES notation for 4-pyridazin-3-ylbenzoic acid?
The canonical SMILES for 4-pyridazin-3-ylbenzoic acid is O=C(O)c1ccc(-c2cccnn2)cc1.
What is the InChIKey of 4-pyridazin-3-ylbenzoic acid?
The InChIKey is FJBBZZOMNVFEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c14-11(15)9-5-3-8(4-6-9)10-2-1-7-12-13-10/h1-7H,(H,14,15).
What are the key properties of 4-pyridazin-3-ylbenzoic acid?
4-pyridazin-3-ylbenzoic acid has a molecular weight of 200.20 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridazin-3-ylbenzoic acid is sourced from PubChem (CID 18182561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).