About 4-ethoxy-3,5-dimethylbenzaldehyde
4-ethoxy-3,5-dimethylbenzaldehyde (PubChem CID 18182978) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-ethoxy-3,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-ethoxy-3,5-dimethylbenzaldehyde |
| PubChem CID | 18182978 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-ethoxy-3,5-dimethylbenzaldehyde |
| SMILES | CCOc1c(C)cc(C=O)cc1C |
| InChI | InChI=1S/C11H14O2/c1-4-13-11-8(2)5-10(7-12)6-9(11)3/h5-7H,4H2,1-3H3 |
| InChIKey | MFIBANLTLFSKKI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-3,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3,5-dimethylbenzaldehyde?
The IUPAC name of 4-ethoxy-3,5-dimethylbenzaldehyde (CID 18182978) is 4-ethoxy-3,5-dimethylbenzaldehyde.
What is the SMILES notation for 4-ethoxy-3,5-dimethylbenzaldehyde?
The canonical SMILES for 4-ethoxy-3,5-dimethylbenzaldehyde is CCOc1c(C)cc(C=O)cc1C.
What is the InChIKey of 4-ethoxy-3,5-dimethylbenzaldehyde?
The InChIKey is MFIBANLTLFSKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-4-13-11-8(2)5-10(7-12)6-9(11)3/h5-7H,4H2,1-3H3.
What are the key properties of 4-ethoxy-3,5-dimethylbenzaldehyde?
4-ethoxy-3,5-dimethylbenzaldehyde has a molecular weight of 178.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3,5-dimethylbenzaldehyde is sourced from PubChem (CID 18182978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).